Difference between revisions of "CPD-12521"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5751 PWY-5751] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12521 CPD-12521] == * smiles: ** C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1) * common name: ** β...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12521 CPD-12521] == |
− | * | + | * smiles: |
− | ** | + | ** C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1) |
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-glucuronate |
+ | * inchi key: | ||
+ | ** InChIKey=AEMOLEFTQBMNLQ-QIUUJYRFSA-M | ||
+ | * molecular weight: | ||
+ | ** 193.133 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-D-glucuronic acid |
− | ** | + | ** β-D-glucopyranuronic acid |
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15291]] | |
− | + | * [[RXN-15289]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11877136 11877136] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10051464.html 10051464] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85313 85313] |
+ | * METABOLIGHTS : MTBLC28860 | ||
+ | {{#set: smiles=C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1)}} | ||
+ | {{#set: common name=β-D-glucuronate}} | ||
+ | {{#set: inchi key=InChIKey=AEMOLEFTQBMNLQ-QIUUJYRFSA-M}} | ||
+ | {{#set: molecular weight=193.133 }} | ||
+ | {{#set: common name=β-D-glucuronic acid|β-D-glucopyranuronic acid}} | ||
+ | {{#set: produced by=RXN-15291|RXN-15289}} |
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-12521
- smiles:
- C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1)
- common name:
- β-D-glucuronate
- inchi key:
- InChIKey=AEMOLEFTQBMNLQ-QIUUJYRFSA-M
- molecular weight:
- 193.133
- Synonym(s):
- β-D-glucuronic acid
- β-D-glucopyranuronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)OC(C(=O)[O-])C(O)1)" cannot be used as a page name in this wiki.