Difference between revisions of "Chlorophyllides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=ZZZCUOFIHG...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chlorophyllides Chlorophyllides] == * common name: ** a chlorophyllide * Synonym(s): == Reacti...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chlorophyllides Chlorophyllides] ==
* smiles:
+
** C(O)C1(C(O)=C(O)C(=O)O1)
+
* inchi key:
+
** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
+
 
* common name:
 
* common name:
** dehydro-D-arabinono-1,4-lactone
+
** a chlorophyllide
* molecular weight:
+
** 146.099   
+
 
* Synonym(s):
 
* Synonym(s):
** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
 
** D-erythro-ascorbic acid
 
** D-erythro-ascorbate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[R06284]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.3.37-RXN]]
+
* [[R03845]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a chlorophyllide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775]
+
{{#set: consumed by=R06284}}
* CHEBI:
+
{{#set: produced by=R03845}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316]
+
{{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}}
+
{{#set: common name=dehydro-D-arabinono-1,4-lactone}}
+
{{#set: molecular weight=146.099    }}
+
{{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}}
+
{{#set: produced by=1.1.3.37-RXN}}
+

Latest revision as of 19:36, 21 March 2018

Metabolite Chlorophyllides

  • common name:
    • a chlorophyllide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links