Difference between revisions of "GLUGLNSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUGLNSYN-PWY GLUGLNSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUGLNSYN-PWY GLUGLNSYN-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** L-glutamate biosynthesis IV |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-glutamate biosynthesis from L-glutamine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
| − | * [[ | + | * [[GLUTAMATE-SYNTHASE-NADH-RXN]] |
| − | + | ** 3 associated gene(s): | |
| − | * [[ | + | *** [[Tiso_gene_11511]] |
| + | *** [[Tiso_gene_1154]] | ||
| + | *** [[Tiso_gene_2581]] | ||
| + | ** 5 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[manual-primary_network]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=L-glutamate biosynthesis IV}} | |
| − | + | {{#set: common name=L-glutamate biosynthesis from L-glutamine}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=1}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:36, 21 March 2018
Pathway GLUGLNSYN-PWY
- taxonomic range:
- common name:
- L-glutamate biosynthesis IV
- Synonym(s):
- L-glutamate biosynthesis from L-glutamine
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- GLUTAMATE-SYNTHASE-NADH-RXN
- 3 associated gene(s):
- 5 reconstruction source(s) associated:
