Difference between revisions of "CPD-8355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-KINASE-RXN SHIKIMATE-KINASE-RXN] == * direction: ** REVERSIBLE * common name: ** 3-dehydr...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * common n...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-KINASE-RXN SHIKIMATE-KINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
 
* common name:
 
* common name:
−
** 3-dehydroquinate_synthase
+
** 1-18:1-2-lysophosphatidylethanolamine
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.1.71 EC-2.7.1.71]
+
** InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
 +
* molecular weight:
 +
** 479.593   
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-18:1-lysoPE
 +
** 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15035]]
−
** 1 [[ATP]][c] '''+''' 1 [[SHIKIMATE]][c] '''<=>''' 1 [[SHIKIMATE-5P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-15067]]
−
** 1 ATP[c] '''+''' 1 shikimate[c] '''<=>''' 1 shikimate 3-phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-15036]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_12435]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_3974]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13121 13121]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=58177709 58177709]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02412 R02412]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74971 74971]
−
* UNIPROT:
+
* HMDB : HMDB11506
−
** [http://www.uniprot.org/uniprot/P0A6D7 P0A6D7]
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O}}
−
** [http://www.uniprot.org/uniprot/Q9PIB5 Q9PIB5]
+
{{#set: common name=1-18:1-2-lysophosphatidylethanolamine}}
−
** [http://www.uniprot.org/uniprot/P07547 P07547]
+
{{#set: inchi key=InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N}}
−
** [http://www.uniprot.org/uniprot/P08566 P08566]
+
{{#set: molecular weight=479.593    }}
−
** [http://www.uniprot.org/uniprot/P43880 P43880]
+
{{#set: common name=1-18:1-lysoPE|1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
−
** [http://www.uniprot.org/uniprot/P63600 P63600]
+
{{#set: consumed by=RXN-15035}}
−
** [http://www.uniprot.org/uniprot/Q9CEU1 Q9CEU1]
+
{{#set: produced by=RXN-15067}}
−
** [http://www.uniprot.org/uniprot/P37944 P37944]
+
{{#set: reversible reaction associated=RXN-15036}}
−
** [http://www.uniprot.org/uniprot/P0A6E1 P0A6E1]
+
−
** [http://www.uniprot.org/uniprot/P10880 P10880]
+
−
** [http://www.uniprot.org/uniprot/Q00497 Q00497]
+
−
** [http://www.uniprot.org/uniprot/P34003 P34003]
+
−
** [http://www.uniprot.org/uniprot/P43906 P43906]
+
−
** [http://www.uniprot.org/uniprot/P72796 P72796]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=3-dehydroquinate_synthase}}
+
−
{{#set: ec number=EC-2.7.1.71}}
+
−
{{#set: gene associated=Tiso_gene_12435|Tiso_gene_3974}}
+
−
{{#set: in pathway=PWY-6163}}
+
−
{{#set: reconstruction category=orthology|manual|annotation}}
+
−
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-8355

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O
  • common name:
    • 1-18:1-2-lysophosphatidylethanolamine
  • inchi key:
    • InChIKey=PYVRVRFVLRNJLY-MZMPXXGTSA-N
  • molecular weight:
    • 479.593
  • Synonym(s):
    • 1-18:1-lysoPE
    • 1-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8355&oldid=42757"