Difference between revisions of "CPD-10332"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == * smiles: ** CC1(N=CC(COP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) |
* common name: | * common name: | ||
| − | ** | + | ** gibberellin44 (open lactone form) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 362.422 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** gibberellin A44 open lactone |
| − | ** | + | ** gibberellin A44 diacid |
| − | ** | + | ** GA44 open lactone |
| + | ** GA44 (open lactone form) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1F-168]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN1F-167]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIPID_MAPS : LMPR0104170008 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095] |
| − | {{#set: smiles= | + | {{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} |
| − | {{#set: common name= | + | {{#set: common name=gibberellin44 (open lactone form)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=362.422 }} |
| − | {{#set: common name= | + | {{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN1F-168}} |
| + | {{#set: produced by=RXN1F-167}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite CPD-10332
- smiles:
- C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- common name:
- gibberellin44 (open lactone form)
- inchi key:
- InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
- molecular weight:
- 362.422
- Synonym(s):
- gibberellin A44 open lactone
- gibberellin A44 diacid
- GA44 open lactone
- GA44 (open lactone form)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.
