Difference between revisions of "PWY-7282"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
** 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast)
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-13]]
+
'''6''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PNKIN-RXN]]
* [[RXN66-12]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_6106]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PNPOXI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1471]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_1007]]
 +
*** [[Tiso_gene_9914]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18748]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PYRIDOXKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6106]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PYRIMSYN3-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_2159]]
 +
*** [[Tiso_gene_16224]]
 +
*** [[Tiso_gene_17192]]
 +
*** [[Tiso_gene_2160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14506 RXN-14506]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14507 RXN-14507]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-3797 RXN3O-3797]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
+
{{#set: common name=4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast)}}
* CHEBI:
+
{{#set: reaction found=6}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
+
{{#set: total reaction=9}}
* HMDB : HMDB12159
+
{{#set: completion rate=67.0}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=442.724    }}
+
{{#set: consumed by=RXN66-13}}
+
{{#set: produced by=RXN66-12}}
+

Latest revision as of 20:37, 21 March 2018

Pathway PWY-7282

  • taxonomic range:
  • common name:
    • 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast)
  • Synonym(s):

Reaction(s) found

6 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links