Difference between revisions of "RXN-16425"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16425 RXN-16425] == * direction: ** LEFT-TO-RIGHT * common name: ** atp-dependent_metalloprotea...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16425 RXN-16425] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** atp-dependent_metalloprotease |
| − | + | ** phosphoacetylglucosamine_mutase | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[N-ACETYL-D-GLUCOSAMINE-6-P]][c] '''+''' 1 [[Phosphoacetylglucosamine-Mutase-P]][c] '''=>''' 1 [[N-ACETYL-D-GLUCOSAMINE-16-BIS-P]][c] '''+''' 1 [[Phosphoacetylglucosamine-Mutase]][c] | |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 N-acetyl-D-glucosamine 6-phosphate[c] '''+''' 1 a phosphorylated phosphoacetylglucosamine mutase[c] '''=>''' 1 N-acetyl-D-glucosamine 1,6-bisphosphate[c] '''+''' 1 a phosphoacetylglucosamine mutase[c] |
| − | * [[ | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_13231]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[Tiso_gene_13230]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=atp-dependent_metalloprotease}} | |
| − | + | {{#set: common name=phosphoacetylglucosamine_mutase}} | |
| − | + | {{#set: gene associated=Tiso_gene_13231|Tiso_gene_13230}} | |
| − | + | {{#set: in pathway=}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} |
| − | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:37, 21 March 2018
Contents
Reaction RXN-16425
- direction:
- LEFT-TO-RIGHT
- common name:
- atp-dependent_metalloprotease
- phosphoacetylglucosamine_mutase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 N-acetyl-D-glucosamine 6-phosphate[c] + 1 a phosphorylated phosphoacetylglucosamine mutase[c] => 1 N-acetyl-D-glucosamine 1,6-bisphosphate[c] + 1 a phosphoacetylglucosamine mutase[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13231
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13230
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
