Difference between revisions of "PWY-7440"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7440 PWY-7440] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2037 TAX-20...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7440 PWY-7440] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2037 TAX-2037] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dTDP-β-L-4-epi-vancosamine biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''8''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| − | == | + | *** [[Tiso_gene_7329]] |
| + | *** [[Tiso_gene_12394]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[DTDPGLUCOSEPP-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_14704]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12404 RXN-12404] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12943 RXN-12943] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15225 RXN-15225] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15226 RXN-15226] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15227 RXN-15227] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15233 RXN-15233] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2037}} | |
| − | + | {{#set: common name=dTDP-β-L-4-epi-vancosamine biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=8}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:37, 21 March 2018
Pathway PWY-7440
- taxonomic range:
- common name:
- dTDP-β-L-4-epi-vancosamine biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 8 reactions in the full pathway
- DTDPGLUCDEHYDRAT-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- DTDPGLUCOSEPP-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
