Difference between revisions of "CPD-14808"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * common name: ** scyllo-inosose...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C1(C(C(C(C(C1O)O)=O)O)O)O
 
* common name:
 
* common name:
** glycerol degradation to butanol
+
** scyllo-inosose
 +
* inchi key:
 +
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
 +
* molecular weight:
 +
** 178.141   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-keto-myo-inositol
 +
** 2,4,6/3,5-pentahydroxycyclohexanone
 +
** 2-inosose
 +
** 2-keto-scyllo-inositol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''8''' reactions found over '''10''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[2PGADEHYDRAT-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[3PGAREARR-RXN]]
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
* [[GAPOXNPHOSPHN-RXN]]
+
* [[PEPDEPHOS-RXN]]
+
* [[PHOSGLYPHOS-RXN]]
+
* [[PWY-6131]]
+
* [[PWY-6583]]
+
* [[TRIOSEPISOMERIZATION-RXN]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=glycerol degradation to butanol}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
{{#set: reaction found=8}}
+
* CHEBI:
{{#set: reaction not found=10}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
{{#set: completion rate=80.0}}
+
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
 +
{{#set: common name=scyllo-inosose}}
 +
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
 +
{{#set: molecular weight=178.141    }}
 +
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
 +
{{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-14808

  • smiles:
    • C1(C(C(C(C(C1O)O)=O)O)O)O
  • common name:
    • scyllo-inosose
  • inchi key:
    • InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
  • molecular weight:
    • 178.141
  • Synonym(s):
    • 2-keto-myo-inositol
    • 2,4,6/3,5-pentahydroxycyclohexanone
    • 2-inosose
    • 2-keto-scyllo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links