Difference between revisions of "CPD-14808"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1295 PWY0-1295] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * common name: ** scyllo-inosose...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C(C(C(C(C1O)O)=O)O)O)O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** scyllo-inosose |
+ | * inchi key: | ||
+ | ** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N | ||
+ | * molecular weight: | ||
+ | ** 178.141 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-keto-myo-inositol | ||
+ | ** 2,4,6/3,5-pentahydroxycyclohexanone | ||
+ | ** 2-inosose | ||
+ | ** 2-keto-scyllo-inositol | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811] |
− | {{#set: | + | {{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}} |
− | {{#set: | + | {{#set: common name=scyllo-inosose}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}} |
− | {{#set: | + | {{#set: molecular weight=178.141 }} |
− | {{#set: | + | {{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}} |
+ | {{#set: reversible reaction associated=MYO-INOSITOL-2-DEHYDROGENASE-RXN}} |
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite CPD-14808
- smiles:
- C1(C(C(C(C(C1O)O)=O)O)O)O
- common name:
- scyllo-inosose
- inchi key:
- InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
- molecular weight:
- 178.141
- Synonym(s):
- 2-keto-myo-inositol
- 2,4,6/3,5-pentahydroxycyclohexanone
- 2-inosose
- 2-keto-scyllo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links