Difference between revisions of "RXN-11479"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE N-ACETYL-D-GLUCOSAMINE] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(O)C(O)1) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11479 RXN-11479] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11479 RXN-11479] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-oxoacyl-synthase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[Glutaryl-ACP-methyl-esters]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[3-Ketopimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H+[c] '''+''' 1 a glutaryl-[acp] methyl ester[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 a 3-oxo-pimeloyl-[acp] methyl ester[c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_19302]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_15991]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_14485]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_5939]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] | ||
| + | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=3-oxoacyl-synthase}} | |
| − | + | {{#set: ec number=EC-2.3.1.41}} | |
| − | + | {{#set: gene associated=Tiso_gene_19302|Tiso_gene_15991|Tiso_gene_14485|Tiso_gene_5939}} | |
| − | + | {{#set: in pathway=PWY-6519}} | |
| − | + | {{#set: reconstruction category=orthology|annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:37, 21 March 2018
Contents
Reaction RXN-11479
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-oxoacyl-synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 Glutaryl-ACP-methyl-esters[c] + 1 MALONYL-ACP[c] => 1 3-Ketopimeloyl-ACP-methyl-esters[c] + 1 CARBON-DIOXIDE[c] + 1 ACP[c]
- With common name(s):
- 1 H+[c] + 1 a glutaryl-[acp] methyl ester[c] + 1 a malonyl-[acp][c] => 1 a 3-oxo-pimeloyl-[acp] methyl ester[c] + 1 CO2[c] + 1 a holo-[acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19302
- Source: orthology-esiliculosus
- Gene: Tiso_gene_15991
- Source: orthology-esiliculosus
- Gene: Tiso_gene_14485
- Source: orthology-esiliculosus
- Gene: Tiso_gene_5939
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
- 9 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
