Difference between revisions of "Tiso gene 18933"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
(Created page with "Category:Gene == Gene Tiso_gene_18933 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.2-RXN ** Source: orthology-esiliculosus * Reaction: RXN490...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
+
== Gene Tiso_gene_18933 ==
* smiles:
+
** C1(C(C(C(C(C1O)O)=O)O)O)O
+
* inchi key:
+
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
+
* common name:
+
** scyllo-inosose
+
* molecular weight:
+
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-keto-myo-inositol
 
** 2,4,6/3,5-pentahydroxycyclohexanone
 
** 2-inosose
 
** 2-keto-scyllo-inositol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.14.11.2-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
* Reaction: [[RXN490-3641]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
+
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
+
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
+
{{#set: common name=scyllo-inosose}}
+
{{#set: molecular weight=178.141    }}
+
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
+
{{#set: consumed or produced by=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:37, 21 March 2018

Gene Tiso_gene_18933

  • Synonym(s):

Reactions associated

Pathways associated

External links