Difference between revisions of "Tiso gene 18933"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Gene == Gene Tiso_gene_18933 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.2-RXN ** Source: orthology-esiliculosus * Reaction: RXN490...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18933 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.14.11.2-RXN]] | |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | * Reaction: [[RXN490-3641]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:37, 21 March 2018
Gene Tiso_gene_18933
- Synonym(s):
Reactions associated
- Reaction: 1.14.11.2-RXN
- Source: orthology-esiliculosus
- Reaction: RXN490-3641
- Source: orthology-esiliculosus