Difference between revisions of "CYCLOARTENOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11479 RXN-11479] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11479 RXN-11479] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
 
* common name:
 
* common name:
−
** 3-oxoacyl-synthase
+
** cycloartenol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
 +
* molecular weight:
 +
** 426.724   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9β,19-cyclo-24-lanosten-3β-ol
 +
** cycloart-24(25)-enol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-4021]]
−
** 1 [[Glutaryl-ACP-methyl-esters]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[3-Ketopimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[CYCLOARTENOL-SYNTHASE-RXN]]
−
** 1 a glutaryl-[acp] methyl ester[c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 a 3-oxo-pimeloyl-[acp] methyl ester[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19302]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_14485]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_5939]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_15991]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 469-38-5
−
{{#set: common name=3-oxoacyl-synthase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.41}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
−
{{#set: gene associated=Tiso_gene_19302|Tiso_gene_14485|Tiso_gene_5939|Tiso_gene_15991}}
+
* HMDB : HMDB36591
−
{{#set: in pathway=PWY-6519}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=cycloartenol}}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
 +
{{#set: molecular weight=426.724    }}
 +
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
 +
{{#set: consumed by=RXN-4021}}
 +
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}

Latest revision as of 19:37, 21 March 2018

Metabolite CYCLOARTENOL

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • common name:
    • cycloartenol
  • inchi key:
    • InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
  • molecular weight:
    • 426.724
  • Synonym(s):
    • 9β,19-cyclo-24-lanosten-3β-ol
    • cycloart-24(25)-enol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CYCLOARTENOL&oldid=42822"