Difference between revisions of "Tiso gene 12434"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
(Created page with "Category:Gene == Gene Tiso_gene_12434 == * Synonym(s): == Reactions associated == * Reaction: GLYCEROL-KIN-RXN ** Source: orthology-athaliana ** Source: ortholo...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Gene Tiso_gene_12434 ==
* smiles:
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
* inchi key:
+
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
* common name:
+
** cycloartenol
+
* molecular weight:
+
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 9β,19-cyclo-24-lanosten-3β-ol
 
** cycloart-24(25)-enol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-4021]]
+
* Reaction: [[GLYCEROL-KIN-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-athaliana]]
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-4261]]
 
== External links  ==
 
== External links  ==
* CAS : 469-38-5
+
{{#set: reaction associated=GLYCEROL-KIN-RXN}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-4261}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
* HMDB : HMDB36591
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
{{#set: common name=cycloartenol}}
+
{{#set: molecular weight=426.724    }}
+
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
{{#set: consumed by=RXN-4021}}
+
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Latest revision as of 20:37, 21 March 2018

Gene Tiso_gene_12434

  • Synonym(s):

Reactions associated

Pathways associated

External links