Difference between revisions of "4-GUANIDO-BUTYRAMIDE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18933 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** pantograph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == * smiles: ** C(NC(N)=[N+])CCC(=O)N * common name:...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == |
| + | * smiles: | ||
| + | ** C(NC(N)=[N+])CCC(=O)N | ||
| + | * common name: | ||
| + | ** 4-guanidinobutyramide | ||
| + | * inchi key: | ||
| + | ** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O | ||
| + | * molecular weight: | ||
| + | ** 145.184 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-guanidinobutanamide | ||
| + | ** 4-guanidobutanamide | ||
| + | ** 4-guanido-butyramide | ||
| + | ** γ-guanidinobutyramide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[GUANIDINOBUTANAMIDE-NH3-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[ARGININE-2-MONOOXYGENASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078] | ||
| + | {{#set: smiles=C(NC(N)=[N+])CCC(=O)N}} | ||
| + | {{#set: common name=4-guanidinobutyramide}} | ||
| + | {{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}} | ||
| + | {{#set: molecular weight=145.184 }} | ||
| + | {{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}} | ||
| + | {{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}} | ||
| + | {{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}} | ||
Latest revision as of 19:37, 21 March 2018
Contents
Metabolite 4-GUANIDO-BUTYRAMIDE
- smiles:
- C(NC(N)=[N+])CCC(=O)N
- common name:
- 4-guanidinobutyramide
- inchi key:
- InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
- molecular weight:
- 145.184
- Synonym(s):
- 4-guanidinobutanamide
- 4-guanidobutanamide
- 4-guanido-butyramide
- γ-guanidinobutyramide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC(N)=[N+])CCC(=O)N" cannot be used as a page name in this wiki.
