Difference between revisions of "CPD-13118"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5324 PWY-5324] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5324 PWY-5324] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
 
* common name:
 
* common name:
** L-lysine degradation IX
+
** GDP-β-L-fucose
 +
* inchi key:
 +
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
 +
* molecular weight:
 +
** 587.33   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[RXN-8173]]
+
* [[1.1.1.271-RXN]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''1''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=LYSINE--PYRUVATE-6-AMINOTRANSFERASE-RXN LYSINE--PYRUVATE-6-AMINOTRANSFERASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
{{#set: common name=L-lysine degradation IX}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
{{#set: reaction found=1}}
+
* CHEBI:
{{#set: reaction not found=1}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
 +
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
 +
{{#set: common name=GDP-β-L-fucose}}
 +
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
 +
{{#set: molecular weight=587.33    }}
 +
{{#set: produced by=1.1.1.271-RXN}}

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-13118

  • smiles:
    • CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
  • common name:
    • GDP-β-L-fucose
  • inchi key:
    • InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
  • molecular weight:
    • 587.33
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)" cannot be used as a page name in this wiki.