Difference between revisions of "PWY-5677"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5677 PWY-5677] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5677 PWY-5677] ==
* smiles:
+
* taxonomic range:
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
* inchi key:
+
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
+
 
* common name:
 
* common name:
** GDP-β-L-fucose
+
** succinate fermentation to butanoate
* molecular weight:
+
** 587.33   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''7''' reactions in the full pathway
* [[1.1.1.271-RXN]]
+
* [[4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_777]]
 +
*** [[Tiso_gene_91]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R11-RXN R11-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8807 RXN-8807]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8889 RXN-8889]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8890 RXN-8890]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8891 RXN-8891]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
+
{{#set: common name=succinate fermentation to butanoate}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
+
{{#set: total reaction=7}}
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
+
{{#set: completion rate=14.0}}
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
+
{{#set: common name=GDP-β-L-fucose}}
+
{{#set: molecular weight=587.33    }}
+
{{#set: produced by=1.1.1.271-RXN}}
+

Latest revision as of 19:38, 21 March 2018

Pathway PWY-5677

  • taxonomic range:
  • common name:
    • succinate fermentation to butanoate
  • Synonym(s):

Reaction(s) found

1 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links