Difference between revisions of "Tiso gene 828"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_828 == * right end position: ** 27885 * transcription direction: ** POSITIVE * left end position: ** 21934 * centisome position: ** 76.7916...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_828 == |
− | * | + | * right end position: |
− | ** | + | ** 27885 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 21934 |
− | * | + | * centisome position: |
− | ** | + | ** 76.79166 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[5.99.1.3-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=27885}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=21934}} | |
− | + | {{#set: centisome position=76.79166 }} | |
− | + | {{#set: reaction associated=5.99.1.3-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:38, 21 March 2018
Gene Tiso_gene_828
- right end position:
- 27885
- transcription direction:
- POSITIVE
- left end position:
- 21934
- centisome position:
- 76.79166
- Synonym(s):
Reactions associated
- Reaction: 5.99.1.3-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation