Difference between revisions of "Tiso gene 10323"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Gene == Gene Tiso_gene_10323 == * Synonym(s): == Reactions associated == * Reaction: 4.2.2.10-RXN ** Source: orthology-esiliculosus == Pathways associate...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_10323 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[4.2.2.10-RXN]] | |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | + | == Pathways associated == | |
| − | * | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=4.2.2.10-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:38, 21 March 2018
Gene Tiso_gene_10323
- Synonym(s):
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: orthology-esiliculosus
