Difference between revisions of "1.1.1.271-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.271-RXN 1.1.1.271-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** GDP-L-fucose syntha...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.271-RXN 1.1.1.271-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** GDP-L-fucose synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.271 EC-1.1.1.271] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-13118]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 GDP-4-dehydro-α-D-rhamnose[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 GDP-β-L-fucose[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16970]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-66]], GDP-L-fucose biosynthesis I (from GDP-D-mannose): [http://metacyc.org/META/NEW-IMAGE?object=PWY-66 PWY-66] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18885 18885] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05692 R05692] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=GDP-L-fucose synthase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.1.1.271}} |
− | + | {{#set: gene associated=Tiso_gene_16970}} | |
− | + | {{#set: in pathway=PWY-66}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-athaliana|annotation-experimental_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Contents
Reaction 1.1.1.271-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- GDP-L-fucose synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE[c] + 1 NADPH[c] + 1 PROTON[c] => 1 NADP[c] + 1 CPD-13118[c]
- With common name(s):
- 1 GDP-4-dehydro-α-D-rhamnose[c] + 1 NADPH[c] + 1 H+[c] => 1 NADP+[c] + 1 GDP-β-L-fucose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16970
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
Pathways
- PWY-66, GDP-L-fucose biosynthesis I (from GDP-D-mannose): PWY-66
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links