Difference between revisions of "IMINOASPARTATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] == * direction: ** LEFT-TO-RIGHT * common name: ** galactose-3-o-sulfotransfer...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * common name: ** 2-i...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)([O-])CC(=N)C(=O)[O-]
 
* common name:
 
* common name:
−
** galactose-3-o-sulfotransferase_2-like
+
** 2-iminosuccinate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
+
** InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 129.072   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-iminobutanedioate
 +
** α-iminosuccinate
 +
** iminoaspartate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[A-GALACTOSYLCERAMIDE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[galactosylceramide-sulfate]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c]
+
* [[L-ASPARTATE-OXID-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a β-D-galactosyl-N-acylsphingosine[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''=>''' 1 a galactosylceramide sulfate[c] '''+''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13030]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7840]], gala-series glycosphingolipids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7840 PWY-7840]
+
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=galactose-3-o-sulfotransferase_2-like}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615393 23615393]
−
{{#set: ec number=EC-2.8.2.11}}
+
* HMDB : HMDB01131
−
{{#set: gene associated=Tiso_gene_13030}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-7840}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05840 C05840]
−
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
** [http://www.chemspider.com/Chemical-Structure.19951415.html 19951415]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58831 58831]
 +
* BIGG : iasp
 +
{{#set: smiles=C(=O)([O-])CC(=N)C(=O)[O-]}}
 +
{{#set: common name=2-iminosuccinate}}
 +
{{#set: inchi key=InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=129.072    }}
 +
{{#set: common name=2-iminobutanedioate|α-iminosuccinate|iminoaspartate}}
 +
{{#set: produced by=L-ASPARTATE-OXID-RXN}}

Latest revision as of 19:38, 21 March 2018

Metabolite IMINOASPARTATE

  • smiles:
    • C(=O)([O-])CC(=N)C(=O)[O-]
  • common name:
    • 2-iminosuccinate
  • inchi key:
    • InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L
  • molecular weight:
    • 129.072
  • Synonym(s):
    • 2-iminobutanedioate
    • α-iminosuccinate
    • iminoaspartate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC(=N)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=IMINOASPARTATE&oldid=42925"