Difference between revisions of "CPD-15687"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5286 RXN-5286] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] == * smiles: ** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5286 RXN-5286] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.1.75 EC-1.3.1.75]
+
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA
 +
* inchi key:
 +
** InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J
 +
* molecular weight:
 +
** 983.813   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5Z, 7E-3-oxo-tetradecadienoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14799]]
−
** 1 [[DIVINYLCHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3,8-divinyl chlorophyllide a[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 chlorophyllide a[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13868]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-5526]], bacteriochlorophyll a biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5526 PWY-5526]
+
−
** '''1''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7760]], bacteriochlorophyll e biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7760 PWY-7760]
+
−
** '''1''' reactions found over '''26''' reactions in the full pathway
+
−
* [[PWY-7758]], bacteriochlorophyll d biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7758 PWY-7758]
+
−
** '''1''' reactions found over '''14''' reactions in the full pathway
+
−
* [[PWY-5086]], chlorophyll a biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5086 PWY-5086]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-7759]], bacteriochlorophyll c biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7759 PWY-7759]
+
−
** '''1''' reactions found over '''18''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14449 14449]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657719 90657719]
−
* LIGAND-RXN:
+
{{#set: smiles=CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R06272 R06272]
+
{{#set: common name=5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J}}
−
{{#set: ec number=EC-1.3.1.75}}
+
{{#set: molecular weight=983.813    }}
−
{{#set: gene associated=Tiso_gene_13868}}
+
{{#set: common name=5Z, 7E-3-oxo-tetradecadienoyl-CoA}}
−
{{#set: in pathway=PWY-5526|PWY-5064|PWY-7760|PWY-7758|PWY-5086|PWY-7759}}
+
{{#set: consumed by=RXN-14799}}
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=creinhardtii}}
+
−
{{#set: reconstruction category=manual}}
+
−
{{#set: reconstruction source=primary_network}}
+

Latest revision as of 20:38, 21 March 2018

Metabolite CPD-15687

  • smiles:
    • CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA
  • inchi key:
    • InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J
  • molecular weight:
    • 983.813
  • Synonym(s):
    • 5Z, 7E-3-oxo-tetradecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15687&oldid=42939"