Difference between revisions of "Non-Glucosylated-Glucose-Acceptors"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucosylated-Glucose-Acceptors Non-Glucosylated-Glucose-Acceptors] == * common name: ** a n...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucosylated-Glucose-Acceptors Non-Glucosylated-Glucose-Acceptors] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a non glucosylated D-glucose acceptor |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a non glucosylated D-glucose donor |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.2.1.21-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a non glucosylated D-glucose acceptor}} | |
| − | + | {{#set: common name=a non glucosylated D-glucose donor}} | |
| − | + | {{#set: produced by=3.2.1.21-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite Non-Glucosylated-Glucose-Acceptors
- common name:
- a non glucosylated D-glucose acceptor
- Synonym(s):
- a non glucosylated D-glucose donor
