Difference between revisions of "Tiso gene 857"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_857 == * right end position: ** 10213 * transcription direction: ** POSITIVE * left end position: ** 8865 * centisome position: ** 31.42725...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_857 == |
− | * | + | * right end position: |
− | ** | + | ** 10213 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 8865 |
− | * | + | * centisome position: |
− | ** | + | ** 31.427256 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=10213}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=8865}} | |
− | + | {{#set: centisome position=31.427256 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:39, 21 March 2018
Gene Tiso_gene_857
- right end position:
- 10213
- transcription direction:
- POSITIVE
- left end position:
- 8865
- centisome position:
- 31.427256
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation