Difference between revisions of "FAO-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == * smiles: ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) * inchi key:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33084 TAX-330...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33084 TAX-33084]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
** InChIKey=RKUNBYITZUJHSG-SPUOUPEWSA-O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** atropine
+
** fatty acid β-oxidation I
−
* molecular weight:
+
−
** 290.381   
+
 
* Synonym(s):
 
* Synonym(s):
−
** d1-hyoscyamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[TROPINESTERASE-RXN]]
+
'''5''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ACYLCOADEHYDROG-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 11 associated gene(s):
 +
*** [[Tiso_gene_5449]]
 +
*** [[Tiso_gene_16631]]
 +
*** [[Tiso_gene_6295]]
 +
*** [[Tiso_gene_8272]]
 +
*** [[Tiso_gene_14511]]
 +
*** [[Tiso_gene_10643]]
 +
*** [[Tiso_gene_8271]]
 +
*** [[Tiso_gene_7447]]
 +
*** [[Tiso_gene_883]]
 +
*** [[Tiso_gene_6475]]
 +
*** [[Tiso_gene_16113]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[ACYLCOASYN-RXN]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_7855]]
 +
*** [[Tiso_gene_9394]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_4191]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_348]]
 +
*** [[Tiso_gene_135]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[ENOYL-COA-HYDRAT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_16145]]
 +
*** [[Tiso_gene_6885]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[KETOACYLCOATHIOL-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_10116]]
 +
*** [[Tiso_gene_17451]]
 +
*** [[Tiso_gene_3856]]
 +
*** [[Tiso_gene_3855]]
 +
*** [[Tiso_gene_15327]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[OHACYL-COA-DEHYDROG-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_18838]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_14027]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-COA-DELTA-ISOM-RXN ENOYL-COA-DELTA-ISOM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OHBUTYRYL-COA-EPIM-RXN OHBUTYRYL-COA-EPIM-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 51-55-8
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=FAO-PWY FAO-PWY]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21608699 21608699]
+
{{#set: taxonomic range=TAX-33084}}
−
* HMDB : HMDB00779
+
{{#set: taxonomic range=TAX-33208}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01479 C01479]
+
{{#set: common name=fatty acid β-oxidation I}}
−
* CHEMSPIDER:
+
{{#set: reaction found=5}}
−
** [http://www.chemspider.com/Chemical-Structure.10246419.html 10246419]
+
{{#set: total reaction=7}}
−
* CHEBI:
+
{{#set: completion rate=71.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57858 57858]
+
−
{{#set: smiles=C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3)))}}
+
−
{{#set: inchi key=InChIKey=RKUNBYITZUJHSG-SPUOUPEWSA-O}}
+
−
{{#set: common name=atropine}}
+
−
{{#set: molecular weight=290.381    }}
+
−
{{#set: common name=d1-hyoscyamine}}
+
−
{{#set: consumed by=TROPINESTERASE-RXN}}
+

Latest revision as of 19:39, 21 March 2018

Pathway FAO-PWY

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=FAO-PWY&oldid=43027"