Difference between revisions of "FAO-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == * smiles: ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33084 TAX-330...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33084 TAX-33084] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** fatty acid β-oxidation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''5''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[ACYLCOADEHYDROG-RXN]] | |
− | == Reaction(s) | + | ** 11 associated gene(s): |
+ | *** [[Tiso_gene_5449]] | ||
+ | *** [[Tiso_gene_16631]] | ||
+ | *** [[Tiso_gene_6295]] | ||
+ | *** [[Tiso_gene_8272]] | ||
+ | *** [[Tiso_gene_14511]] | ||
+ | *** [[Tiso_gene_10643]] | ||
+ | *** [[Tiso_gene_8271]] | ||
+ | *** [[Tiso_gene_7447]] | ||
+ | *** [[Tiso_gene_883]] | ||
+ | *** [[Tiso_gene_6475]] | ||
+ | *** [[Tiso_gene_16113]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[ACYLCOASYN-RXN]] | ||
+ | ** 9 associated gene(s): | ||
+ | *** [[Tiso_gene_136]] | ||
+ | *** [[Tiso_gene_7855]] | ||
+ | *** [[Tiso_gene_9394]] | ||
+ | *** [[Tiso_gene_10876]] | ||
+ | *** [[Tiso_gene_4191]] | ||
+ | *** [[Tiso_gene_13394]] | ||
+ | *** [[Tiso_gene_500]] | ||
+ | *** [[Tiso_gene_348]] | ||
+ | *** [[Tiso_gene_135]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[ENOYL-COA-HYDRAT-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_16145]] | ||
+ | *** [[Tiso_gene_6885]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[KETOACYLCOATHIOL-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_10116]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | *** [[Tiso_gene_3856]] | ||
+ | *** [[Tiso_gene_3855]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[OHACYL-COA-DEHYDROG-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | *** [[Tiso_gene_18838]] | ||
+ | *** [[Tiso_gene_18839]] | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_14026]] | ||
+ | *** [[Tiso_gene_14027]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-COA-DELTA-ISOM-RXN ENOYL-COA-DELTA-ISOM-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=OHBUTYRYL-COA-EPIM-RXN OHBUTYRYL-COA-EPIM-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=FAO-PWY FAO-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-33084}} |
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=fatty acid β-oxidation I}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=71.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Pathway FAO-PWY
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- ACYLCOADEHYDROG-RXN
- 11 associated gene(s):
- 2 reconstruction source(s) associated:
- ACYLCOASYN-RXN
- 9 associated gene(s):
- 3 reconstruction source(s) associated:
- ENOYL-COA-HYDRAT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- KETOACYLCOATHIOL-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated:
- OHACYL-COA-DEHYDROG-RXN
- 6 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: