Difference between revisions of "Tiso gene 1587"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] == * smiles: ** C1(C(O)C(CO)OC1OP(=O)([O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_1587 == * right end position: ** 9663 * transcription direction: ** POSITIVE * left end position: ** 8970 * centisome position: ** 38.92891...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] ==
+
== Gene Tiso_gene_1587 ==
−
* smiles:
+
* right end position:
−
** C1(C(O)C(CO)OC1OP(=O)([O-])[O-])
+
** 9663
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2-deoxy-α-D-ribose 1-phosphate
+
** 8970
−
* molecular weight:
+
* centisome position:
−
** 212.096    
+
** 38.92891    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxy-D-ribose 1-phosphate
 
−
** 2-deoxy-D-ribose-1-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[THYM-PHOSPH-RXN]]
+
*** Assignment: ec-number
−
* [[URA-PHOSPH-RXN]]
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=9663}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23419734 23419734]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=8970}}
−
** [http://www.chemspider.com/Chemical-Structure.10461471.html 10461471]
+
{{#set: centisome position=38.92891   }}
−
* CHEBI:
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57259 57259]
+
{{#set: pathway associated=PWY-7511}}
−
* BIGG : 2dr1p
+
−
* HMDB : HMDB01351
+
−
{{#set: smiles=C1(C(O)C(CO)OC1OP(=O)([O-])[O-])}}
+
−
{{#set: inchi key=InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L}}
+
−
{{#set: common name=2-deoxy-α-D-ribose 1-phosphate}}
+
−
{{#set: molecular weight=212.096   }}
+
−
{{#set: common name=deoxy-D-ribose 1-phosphate|2-deoxy-D-ribose-1-phosphate}}
+
−
{{#set: consumed or produced by=THYM-PHOSPH-RXN|URA-PHOSPH-RXN}}
+

Latest revision as of 19:39, 21 March 2018

Gene Tiso_gene_1587

  • right end position:
    • 9663
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8970
  • centisome position:
    • 38.92891
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1587&oldid=43029"