Difference between revisions of "PWY-7801"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7801 PWY-7801] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7801 PWY-7801] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** ( | + | ** N-end rule pathway I (prokaryotic) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''2''' reactions in the full pathway |
| − | + | * [[LEUCYLTRANSFERASE-RXN]] | |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Tiso_gene_13698]] | ||
| + | *** [[Tiso_gene_8540]] | ||
| + | *** [[Tiso_gene_2584]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-17846]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Tiso_gene_8540]] | ||
| + | *** [[Tiso_gene_13698]] | ||
| + | *** [[Tiso_gene_2584]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7801 PWY-7801] |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=N-end rule pathway I (prokaryotic)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name=( | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:39, 21 March 2018
Pathway PWY-7801
- taxonomic range:
- common name:
- N-end rule pathway I (prokaryotic)
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- LEUCYLTRANSFERASE-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-17846
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
