Difference between revisions of "SUCROSE-6P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9658 RXN-9658] == * direction: ** LEFT-TO-RIGHT * common name: ** trans hex-2-enoyl-[acp]-reduc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2) |
* common name: | * common name: | ||
| − | ** | + | ** sucrose 6F-phosphate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L |
| + | * molecular weight: | ||
| + | ** 420.263 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** sucrose-6F-P | ||
| + | ** 6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[BFFS]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[SUCROSE-PHOSPHATE-SYNTHASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245080 25245080] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57723 57723] |
| − | {{#set: | + | * BIGG : suc6p |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02591 C02591] |
| − | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)}} |
| + | {{#set: common name=sucrose 6F-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L}} | ||
| + | {{#set: molecular weight=420.263 }} | ||
| + | {{#set: common name=sucrose-6F-P|6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside}} | ||
| + | {{#set: consumed by=BFFS}} | ||
| + | {{#set: produced by=SUCROSE-PHOSPHATE-SYNTHASE-RXN}} | ||
Latest revision as of 19:39, 21 March 2018
Contents
Metabolite SUCROSE-6P
- smiles:
- C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)
- common name:
- sucrose 6F-phosphate
- inchi key:
- InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L
- molecular weight:
- 420.263
- Synonym(s):
- sucrose-6F-P
- 6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)" cannot be used as a page name in this wiki.
