Difference between revisions of "PWY-7119"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == * smiles: ** CC...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7119 PWY-7119] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7119 PWY-7119] ==
−
* smiles:
+
* taxonomic range:
−
** CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
−
** InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L
+
 
* common name:
 
* common name:
−
** 2-C-methyl-D-erythritol-2,4-cyclodiphosphate
+
** sphingolipid recycling and degradation (yeast)
−
* molecular weight:
+
−
** 276.076   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ME-2,4cPP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN0-882]]
+
'''5''' reactions found over '''11''' reactions in the full pathway
−
* [[RXN-15878]]
+
* [[CERAMIDASE-YEAST-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
−
* [[RXN0-302]]
+
*** [[Tiso_gene_14341]]
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[HDS]]
+
*** [[orthology-esiliculosus]]
 +
* [[RXN-13729]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_105]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-13733]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14341]]
 +
*** [[Tiso_gene_4555]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_105]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[SPHINGANINE-KINASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_1163]]
 +
*** [[Tiso_gene_14560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DHS-PHOSPHATASE-RXN DHS-PHOSPHATASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13730 RXN-13730]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13731 RXN-13731]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13732 RXN-13732]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-458 RXN3O-458]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-504 RXN3O-504]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21605869 21605869]
+
{{#set: common name=sphingolipid recycling and degradation (yeast)}}
−
* CHEMSPIDER:
+
{{#set: reaction found=5}}
−
** [http://www.chemspider.com/Chemical-Structure.10241147.html 10241147]
+
{{#set: total reaction=11}}
−
* CHEBI:
+
{{#set: completion rate=45.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58483 58483]
+
−
* BIGG : 2mecdp
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11453 C11453]
+
−
{{#set: smiles=CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)}}
+
−
{{#set: inchi key=InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L}}
+
−
{{#set: common name=2-C-methyl-D-erythritol-2,4-cyclodiphosphate}}
+
−
{{#set: molecular weight=276.076    }}
+
−
{{#set: common name=ME-2,4cPP}}
+
−
{{#set: consumed by=RXN0-882|RXN-15878}}
+
−
{{#set: produced by=RXN0-302}}
+
−
{{#set: consumed or produced by=HDS}}
+

Latest revision as of 19:39, 21 March 2018

Pathway PWY-7119

  • taxonomic range:
  • common name:
    • sphingolipid recycling and degradation (yeast)
  • Synonym(s):

Reaction(s) found

5 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7119&oldid=43068"