Difference between revisions of "DEOXY-D-RIBOSE-1-PHOSPHATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGHYD-RXN ASPARAGHYD-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** asparaginase * ec...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] == * smiles: ** C1(C(O)C(CO)OC1OP(=O)([O...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXY-D-RIBOSE-1-PHOSPHATE DEOXY-D-RIBOSE-1-PHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C(O)C(CO)OC1OP(=O)([O-])[O-]) |
* common name: | * common name: | ||
− | ** | + | ** 2-deoxy-α-D-ribose 1-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L |
− | ** | + | * molecular weight: |
+ | ** 212.096 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** deoxy-D-ribose 1-phosphate | ||
+ | ** 2-deoxy-D-ribose-1-phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[THYM-PHOSPH-RXN]] | |
− | + | * [[URA-PHOSPH-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23419734 23419734] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.10461471.html 10461471] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57259 57259] | |
− | * | + | * BIGG : 2dr1p |
− | ** [http://www. | + | * HMDB : HMDB01351 |
− | + | {{#set: smiles=C1(C(O)C(CO)OC1OP(=O)([O-])[O-])}} | |
− | + | {{#set: common name=2-deoxy-α-D-ribose 1-phosphate}} | |
− | * | + | {{#set: inchi key=InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L}} |
− | * | + | {{#set: molecular weight=212.096 }} |
− | + | {{#set: common name=deoxy-D-ribose 1-phosphate|2-deoxy-D-ribose-1-phosphate}} | |
− | + | {{#set: reversible reaction associated=THYM-PHOSPH-RXN|URA-PHOSPH-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:40, 21 March 2018
Contents
Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE
- smiles:
- C1(C(O)C(CO)OC1OP(=O)([O-])[O-])
- common name:
- 2-deoxy-α-D-ribose 1-phosphate
- inchi key:
- InChIKey=KBDKAJNTYKVSEK-VPENINKCSA-L
- molecular weight:
- 212.096
- Synonym(s):
- deoxy-D-ribose 1-phosphate
- 2-deoxy-D-ribose-1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)C(CO)OC1OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.