Difference between revisions of "PWY-6659"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6659 PWY-6659] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6659 PWY-6659] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** fusicoccin A biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''8''' reactions in the full pathway |
| − | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] | |
| − | * [[ | + | ** 2 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_7305]] |
| − | * [[ | + | *** [[Tiso_gene_16284]] |
| + | ** 6 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10632 RXN-10632] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15599 RXN-15599] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15600 RXN-15600] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15601 RXN-15601] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15602 RXN-15602] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15603 RXN-15603] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15604 RXN-15604] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=fusicoccin A biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=8}} | |
| − | + | {{#set: completion rate=13.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:40, 21 March 2018
Pathway PWY-6659
- taxonomic range:
- common name:
- fusicoccin A biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 8 reactions in the full pathway
- FARNESYLTRANSTRANSFERASE-RXN
- 2 associated gene(s):
- 6 reconstruction source(s) associated:
