Difference between revisions of "RXN-12610"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] == * smiles: ** CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12610 RXN-12610] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** thiamine_monophospha...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12610 RXN-12610] ==
−
* smiles:
+
* direction:
−
** CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L
+
 
* common name:
 
* common name:
−
** 2-C-methyl-D-erythritol-2,4-cyclodiphosphate
+
** ORF
−
* molecular weight:
+
** thiamine_monophosphate_synthase
−
** 276.076   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.5.1.3 EC-2.5.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** ME-2,4cPP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-882]]
+
* With identifiers:
−
* [[RXN-15878]]
+
** 2 [[PROTON]][c] '''+''' 1 [[CPD-13576]][c] '''+''' 1 [[AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP]][c] '''=>''' 1 [[THIAMINE-P]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN0-302]]
+
** 2 H+[c] '''+''' 1 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate[c] '''+''' 1 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine[c] '''=>''' 1 thiamine phosphate[c] '''+''' 1 diphosphate[c] '''+''' 1 CO2[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[HDS]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2159]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10320]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2160]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6907]], thiamine diphosphate biosynthesis III (Staphylococcus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6907 PWY-6907]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-6893]], thiamine diphosphate biosynthesis II (Bacillus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6893 PWY-6893]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21605869 21605869]
+
{{#set: common name=ORF}}
−
* CHEMSPIDER:
+
{{#set: common name=thiamine_monophosphate_synthase}}
−
** [http://www.chemspider.com/Chemical-Structure.10241147.html 10241147]
+
{{#set: ec number=EC-2.5.1.3}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_2159|Tiso_gene_10320|Tiso_gene_2160}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58483 58483]
+
{{#set: in pathway=PWY-6907|PWY-6893}}
−
* BIGG : 2mecdp
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11453 C11453]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC1(CO)(OP(=O)([O-])OP(=O)([O-])OCC(O)1)}}
+
−
{{#set: inchi key=InChIKey=SFRQRNJMIIUYDI-UHNVWZDZSA-L}}
+
−
{{#set: common name=2-C-methyl-D-erythritol-2,4-cyclodiphosphate}}
+
−
{{#set: molecular weight=276.076    }}
+
−
{{#set: common name=ME-2,4cPP}}
+
−
{{#set: consumed by=RXN0-882|RXN-15878}}
+
−
{{#set: produced by=RXN0-302}}
+
−
{{#set: reversible reaction associated=HDS}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-12610

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
    • thiamine_monophosphate_synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6907, thiamine diphosphate biosynthesis III (Staphylococcus): PWY-6907
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-6893, thiamine diphosphate biosynthesis II (Bacillus): PWY-6893
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12610&oldid=43126"