Difference between revisions of "RXN-6341"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == * smiles: ** CC(C)C(O)(CC(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6341 RXN-6341] == * direction: ** REVERSIBLE * common name: ** bifunctional_protein ** folylpol...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6341 RXN-6341] ==
−
* smiles:
+
* direction:
−
** CC(C)C(O)(CC(=O)[O-])C([O-])=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L
+
 
* common name:
 
* common name:
−
** (2S)-2-isopropylmalate
+
** bifunctional_protein
−
* molecular weight:
+
** folylpolyglutamate_synthase
−
** 174.153   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.3.2.17 EC-6.3.2.17]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-4-methyl-3-carboxypentanoate
 
−
** 3-carboxy-3-hydroxy-4-methylpentanoate
 
−
** 3-carboxy-3-hydroxy-isocaproate
 
−
** α-isopropylmalate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[IPMS]]
+
** 1 [[N5-Formyl-THF-Glu-N]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[GLT]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[N5-Formyl-THF-Glu-N]][c] '''+''' 1 [[Pi]][c]
−
* [[2-ISOPROPYLMALATESYN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 an (6S)-N5-formyl-tetrahydrofolate[c] '''+''' 1 ATP[c] '''+''' 1 L-glutamate[c] '''<=>''' 1 ADP[c] '''+''' 1 an (6S)-N5-formyl-tetrahydrofolate[c] '''+''' 1 phosphate[c]
−
* [[3-ISOPROPYLMALISOM-RXN]]
+
 
−
* [[RXN-13163]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15942]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_92]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419726 6419726]
+
{{#set: common name=bifunctional_protein}}
−
* HMDB : HMDB00402
+
{{#set: common name=folylpolyglutamate_synthase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-6.3.2.17}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02504 C02504]
+
{{#set: gene associated=Tiso_gene_15942|Tiso_gene_92}}
−
* CHEMSPIDER:
+
{{#set: in pathway=}}
−
** [http://www.chemspider.com/Chemical-Structure.4925359.html 4925359]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1178 1178]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : 3c3hmp
+
−
{{#set: smiles=CC(C)C(O)(CC(=O)[O-])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L}}
+
−
{{#set: common name=(2S)-2-isopropylmalate}}
+
−
{{#set: molecular weight=174.153    }}
+
−
{{#set: common name=3-hydroxy-4-methyl-3-carboxypentanoate|3-carboxy-3-hydroxy-4-methylpentanoate|3-carboxy-3-hydroxy-isocaproate|&alpha;-isopropylmalate}}
+
−
{{#set: produced by=IPMS|2-ISOPROPYLMALATESYN-RXN}}
+
−
{{#set: consumed or produced by=3-ISOPROPYLMALISOM-RXN|RXN-13163}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-6341

  • direction:
    • REVERSIBLE
  • common name:
    • bifunctional_protein
    • folylpolyglutamate_synthase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an (6S)-N5-formyl-tetrahydrofolate[c] + 1 ATP[c] + 1 L-glutamate[c] <=> 1 ADP[c] + 1 an (6S)-N5-formyl-tetrahydrofolate[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-6341&oldid=43129"