Difference between revisions of "RUMP-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=RUMP-PWY RUMP-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=RUMP-PWY RUMP-PWY] ==
* smiles:
+
* taxonomic range:
** C(O)C(O)C([N+])C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
+
 
* common name:
 
* common name:
** 4-hydroxy-L-threonine
+
** formaldehyde oxidation I
* molecular weight:
+
** 135.119   
+
 
* Synonym(s):
 
* Synonym(s):
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
 
** hydroxythreonine
 
** 3-hydroxyhomoserine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''6''' reactions in the full pathway
* [[RXN-14125]]
+
* [[6PGLUCONOLACT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 5 associated gene(s):
 +
*** [[Tiso_gene_10799]]
 +
*** [[Tiso_gene_20412]]
 +
*** [[Tiso_gene_5901]]
 +
*** [[Tiso_gene_15950]]
 +
*** [[Tiso_gene_8585]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[GLU6PDEHYDROG-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_16918]]
 +
*** [[Tiso_gene_14877]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PGLUCISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_19480]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R10-RXN R10-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R12-RXN R12-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3341 RXN-3341]
 
== External links  ==
 
== External links  ==
* CAS : 21768-45-6
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=formaldehyde oxidation I}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420]
+
{{#set: reaction found=3}}
* LIGAND-CPD:
+
{{#set: total reaction=6}}
** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056]
+
{{#set: completion rate=50.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904]
+
* BIGG : 4hthr
+
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}}
+
{{#set: common name=4-hydroxy-L-threonine}}
+
{{#set: molecular weight=135.119    }}
+
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}}
+
{{#set: produced by=RXN-14125}}
+

Latest revision as of 20:40, 21 March 2018

Pathway RUMP-PWY

  • taxonomic range:
  • common name:
    • formaldehyde oxidation I
  • Synonym(s):

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links