Difference between revisions of "Tiso gene 8878"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Adenines 3-Methyl-Adenines] == * smiles: ** CN1(C2(=NC=NC(=C(N)N=C1)2)) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_8878 == * right end position: ** 8991 * transcription direction: ** POSITIVE * left end position: ** 7495 * centisome position: ** 76.425...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8878 == |
− | * | + | * right end position: |
− | ** | + | ** 8991 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 7495 |
− | * | + | * centisome position: |
− | ** | + | ** 76.425 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8991}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=7495}} | |
− | + | {{#set: centisome position=76.425 }} | |
− | + | {{#set: reaction associated=NICOTINAMIDE-N-METHYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:40, 21 March 2018
Gene Tiso_gene_8878
- right end position:
- 8991
- transcription direction:
- POSITIVE
- left end position:
- 7495
- centisome position:
- 76.425
- Synonym(s):
Reactions associated
- Reaction: NICOTINAMIDE-N-METHYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation