Difference between revisions of "Tiso gene 9922"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...")
(Created page with "Category:Gene == Gene Tiso_gene_9922 == * right end position: ** 6446 * transcription direction: ** NEGATIVE * left end position: ** 4457 * centisome position: ** 49.67123...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] ==
+
== Gene Tiso_gene_9922 ==
−
* smiles:
+
* right end position:
−
** C(O)C(O)C([N+])C(=O)[O-]
+
** 6446
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 4-hydroxy-L-threonine
+
** 4457
−
* molecular weight:
+
* centisome position:
−
** 135.119    
+
** 49.671234    
 
* Synonym(s):
 
* Synonym(s):
−
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
 
−
** hydroxythreonine
 
−
** 3-hydroxyhomoserine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3PGAREARR-RXN]]
−
* [[RXN-14125]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-15509]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15510]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15511]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15512]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15513]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[P341-PWY]]
 +
* [[PWY-2221]]
 +
* [[PWY-1622]]
 +
* [[GLUCONEO-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6901]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-7218]]
 +
* [[PWY-6405]]
 +
* [[P124-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY66-399]]
 +
* [[PWY-5723]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY-7124]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 
== External links  ==
 
== External links  ==
−
* CAS : 21768-45-6
+
{{#set: right end position=6446}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420]
+
{{#set: left end position=4457}}
−
* LIGAND-CPD:
+
{{#set: centisome position=49.671234   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056]
+
{{#set: reaction associated=3PGAREARR-RXN|RXN-15509|RXN-15510|RXN-15511|RXN-15512|RXN-15513}}
−
* CHEMSPIDER:
+
{{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|PWY-1622|GLUCONEO-PWY|GLYCOLYSIS|PWY-6901|ANAGLYCOLYSIS-PWY|PWY-7218|PWY-6405|P124-PWY|PWY-6886|PWY66-399|PWY-5723|PWY-6142|PWY-5484|PWY-7124|P122-PWY|PWY-7003}}
−
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904]
+
−
* BIGG : 4hthr
+
−
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}}
+
−
{{#set: common name=4-hydroxy-L-threonine}}
+
−
{{#set: molecular weight=135.119   }}
+
−
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}}
+
−
{{#set: produced by=RXN-14125}}
+

Latest revision as of 19:40, 21 March 2018

Gene Tiso_gene_9922

  • right end position:
    • 6446
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4457
  • centisome position:
    • 49.671234
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9922&oldid=43150"