Difference between revisions of "RXN-8629"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-6-SOLANYL-14-BENZOQUINONE 2-METHYL-6-SOLANYL-14-BENZOQUINONE] == * smiles: ** CC(=CCCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8629 RXN-8629] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.8.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-6-SOLANYL-14-BENZOQUINONE 2-METHYL-6-SOLANYL-14-BENZOQUINONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8629 RXN-8629] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCC1(=C(O)C(C)=CC(O)=C1))C)C)C)C
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=SWKACZQJGXABCN-JSGWLJPKSA-N
+
** [http://enzyme.expasy.org/EC/1.8.1.4 EC-1.8.1.4]
−
* common name:
+
−
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
+
−
* molecular weight:
+
−
** 737.203   
+
 
* Synonym(s):
 
* Synonym(s):
−
** MSBQ
 
−
** 2-methyl-6-solanesyl-1,4-benzoquinol
 
−
** 2-methyl-6--all-trans-nonaprenyl-benzene-1,4-diol
 
−
** 2-methyl-6-solanyl-1,4-benzoquinol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-2762]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[DIHYDROLIPOYL-GCVH]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[PROTEIN-LIPOYLLYSINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
−
* [[R600]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a [glycine-cleavage complex H protein] N6-dihydrolipoyl-L-lysine[c] '''+''' 1 NAD+[c] '''<=>''' 1 a [glycine-cleavage complex H protein] N6-lipoyl-L-lysine[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9330]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[GLYCLEAV-PWY]], glycine cleavage: [http://metacyc.org/META/NEW-IMAGE?object=GLYCLEAV-PWY GLYCLEAV-PWY]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237185 44237185]
+
{{#set: ec number=EC-1.8.1.4}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_9330}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75402 75402]
+
{{#set: in pathway=GLYCLEAV-PWY}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C17570 C17570]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCC1(=C(O)C(C)=CC(O)=C1))C)C)C)C}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=SWKACZQJGXABCN-JSGWLJPKSA-N}}
+
−
{{#set: common name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
+
−
{{#set: molecular weight=737.203    }}
+
−
{{#set: common name=MSBQ|2-methyl-6-solanesyl-1,4-benzoquinol|2-methyl-6--all-trans-nonaprenyl-benzene-1,4-diol|2-methyl-6-solanyl-1,4-benzoquinol}}
+
−
{{#set: consumed by=RXN-2762}}
+
−
{{#set: produced by=R600}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-8629

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a [glycine-cleavage complex H protein] N6-dihydrolipoyl-L-lysine[c] + 1 NAD+[c] <=> 1 a [glycine-cleavage complex H protein] N6-lipoyl-L-lysine[c] + 1 H+[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8629&oldid=43153"