Difference between revisions of "RXN-13303"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13303 RXN-13303] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13303 RXN-13303] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
+
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
−
* inchi key:
+
−
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
+
−
* molecular weight:
+
−
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-14]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-14276]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-14281]][c]
−
* [[RXN66-13]]
+
* With common name(s):
−
* [[RXN-13707]]
+
** 1 (3R)-3-hydroxy-behenoyl-CoA[c] '''=>''' 1 H2O[c] '''+''' 1 trans-docos-2-enoyl-CoA[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
 +
** '''16''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167817 167817]
+
{{#set: ec number=EC-4.2.1.134}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7036}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
+
−
{{#set: molecular weight=412.698    }}
+
−
{{#set: consumed by=RXN66-14}}
+
−
{{#set: produced by=RXN66-13|RXN-13707}}
+

Latest revision as of 20:40, 21 March 2018

Reaction RXN-13303

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (3R)-3-hydroxy-behenoyl-CoA[c] => 1 H2O[c] + 1 trans-docos-2-enoyl-CoA[c]

Genes associated with this reaction

Pathways

  • PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
    • 16 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13303&oldid=43168"