Difference between revisions of "PWY-2261"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * inchi ke...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2261 PWY-2261] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2261 PWY-2261] ==
−
* smiles:
+
* taxonomic range:
−
** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
** InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 
* common name:
 
* common name:
−
** isochorismate
+
** ascorbate glutathione cycle
−
* molecular weight:
+
−
** 224.17   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Isochorismic acid
+
** hydrogen peroxide detoxification
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[2.5.1.64-RXN]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-3521]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
−
* [[ISOCHORSYN-RXN]]
+
*** [[Tiso_gene_16028]]
 +
*** [[Tiso_gene_15962]]
 +
*** [[Tiso_gene_5435]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-3523]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.8.5.1-RXN 1.8.5.1-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3522 RXN-3522]
 
== External links  ==
 
== External links  ==
−
* CAS : 22642-82-6
+
* ARACYC:
−
* DRUGBANK : DB02793
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-2261 PWY-2261]
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33682}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460580 5460580]
+
{{#set: taxonomic range=TAX-33090}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-1117}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00885 C00885]
+
{{#set: common name=ascorbate glutathione cycle}}
−
* CHEMSPIDER:
+
{{#set: common name=hydrogen peroxide detoxification}}
−
** [http://www.chemspider.com/Chemical-Structure.4574080.html 4574080]
+
{{#set: reaction found=2}}
−
* CHEBI:
+
{{#set: total reaction=4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29780 29780]
+
{{#set: completion rate=50.0}}
−
* BIGG : ichor
+
−
{{#set: smiles=C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L}}
+
−
{{#set: common name=isochorismate}}
+
−
{{#set: molecular weight=224.17    }}
+
−
{{#set: common name=Isochorismic acid}}
+
−
{{#set: consumed by=2.5.1.64-RXN}}
+
−
{{#set: reversible reaction associated=ISOCHORSYN-RXN}}
+

Latest revision as of 19:41, 21 March 2018

Pathway PWY-2261

  • taxonomic range:
  • common name:
    • ascorbate glutathione cycle
  • Synonym(s):
    • hydrogen peroxide detoxification

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-2261&oldid=43245"