Difference between revisions of "PWY-7606"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=MXHRCPNRJAMMIM-SHYZEUOFSA-N
+
 
* common name:
 
* common name:
−
** 2'-deoxyuridine
+
** docosahexaenoate biosynthesis III (6-desaturase, mammals)
−
* molecular weight:
+
−
** 228.204   
+
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyuridine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''14''' reactions found over '''14''' reactions in the full pathway
−
* [[RXN-14143]]
+
* [[RXN-13442]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
−
* [[URA-PHOSPH-RXN]]
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-13443]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_9871]]
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_9885]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-13444]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-13445]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-16082]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16103]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16129]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9871]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-16130]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-16131]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-16132]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16134]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18566]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16135]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16136]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-16137]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_17451]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_3856]]
 +
*** [[Tiso_gene_10116]]
 +
*** [[Tiso_gene_3855]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 951-78-0
+
{{#set: taxonomic range=TAX-33208}}
−
* METABOLIGHTS : MTBLC16450
+
{{#set: taxonomic range=TAX-2759}}
−
* DRUGBANK : DB02256
+
{{#set: common name=docosahexaenoate biosynthesis III (6-desaturase, mammals)}}
−
* PUBCHEM:
+
{{#set: reaction found=14}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13712 13712]
+
{{#set: total reaction=14}}
−
* HMDB : HMDB00012
+
{{#set: completion rate=100.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00526 C00526]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13118.html 13118]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16450 16450]
+
−
* BIGG : duri
+
−
{{#set: smiles=C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2))}}
+
−
{{#set: inchi key=InChIKey=MXHRCPNRJAMMIM-SHYZEUOFSA-N}}
+
−
{{#set: common name=2'-deoxyuridine}}
+
−
{{#set: molecular weight=228.204    }}
+
−
{{#set: common name=deoxyuridine}}
+
−
{{#set: produced by=RXN-14143}}
+
−
{{#set: reversible reaction associated=URA-PHOSPH-RXN}}
+

Latest revision as of 20:41, 21 March 2018

Pathway PWY-7606

  • taxonomic range:
  • common name:
    • docosahexaenoate biosynthesis III (6-desaturase, mammals)
  • Synonym(s):

Reaction(s) found

14 reactions found over 14 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7606&oldid=43260"