Difference between revisions of "Tiso gene 13951"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SCOPOLIN SCOPOLIN] == * smiles: ** COC2(=CC1(=C(OC(C=C1)=O)C=C2OC3(C(C(C(O)C(CO)O3)O)O))) * inc...") |
(Created page with "Category:Gene == Gene Tiso_gene_13951 == * Synonym(s): ** Psb27 == Reactions associated == * Reaction: PSII-RXN ** Source: orthology-esiliculosus * Reaction: RX...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13951 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Psb27 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PSII-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | == | + | * Reaction: [[RXN-15448]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-101]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Psb27}} | |
− | + | {{#set: reaction associated=PSII-RXN|RXN-15448}} | |
− | + | {{#set: pathway associated=PWY-101}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:41, 21 March 2018
Gene Tiso_gene_13951
- Synonym(s):
- Psb27
Reactions associated
- Reaction: PSII-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-15448
- Source: orthology-esiliculosus