Difference between revisions of "CPD-15530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROPIONATE PROPIONATE] == * smiles: ** CCC(=O)[O-] * inchi key: ** InChIKey=XBDQKXXYIPTUBI-UHFF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehydo-D-glucuronate |
| + | * inchi key: | ||
| + | ** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 193.133 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** aldehydo-D-glucuronic acid |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-14693]] |
| + | * [[GLUCUROISOM-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953] |
| − | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | |
| − | {{#set: smiles= | + | {{#set: common name=aldehydo-D-glucuronate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=193.133 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=aldehydo-D-glucuronic acid}} |
| − | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-14693|GLUCUROISOM-RXN}} |
| − | {{#set: reversible reaction associated=RXN- | + | |
Latest revision as of 19:42, 21 March 2018
Contents
Metabolite CPD-15530
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
- common name:
- aldehydo-D-glucuronate
- inchi key:
- InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
- molecular weight:
- 193.133
- Synonym(s):
- aldehydo-D-glucuronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
