Difference between revisions of "RXN-11403"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11403 RXN-11403] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11403 RXN-11403] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
* common name:
+
** chlorophyll a
+
* molecular weight:
+
** 892.495   
+
 
* Synonym(s):
 
* Synonym(s):
** chlorophyll a (phytol)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RME294]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[L-DOPACHROME]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[DIHYDROXYINDOLE]][c]
* [[RXN-17428]]
+
* With common name(s):
* [[R06284]]
+
** 1 L-dopachrome[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 5,6-dihydroxyindole[c]
* [[RXN-7666]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
* [[RXN1F-66]]
+
== Pathways  ==
 +
* [[PWY-6498]], eumelanin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6498 PWY-6498]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 479-61-8
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03674 R03674]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
+
{{#set: direction=LEFT-TO-RIGHT}}
* KNAPSACK : C00001528
+
{{#set: in pathway=PWY-6498}}
* HMDB : HMDB38578
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyll a}}
+
{{#set: molecular weight=892.495    }}
+
{{#set: common name=chlorophyll a (phytol)}}
+
{{#set: consumed by=RME294}}
+
{{#set: produced by=RXN-17428|R06284|RXN-7666}}
+
{{#set: consumed or produced by=RXN1F-66}}
+

Latest revision as of 19:42, 21 March 2018

Reaction RXN-11403

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6498, eumelanin biosynthesis: PWY-6498
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links