Difference between revisions of "CPD-2744"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHALCONE-ISOMERASE-RXN CHALCONE-ISOMERASE-RXN] == * direction: ** REVERSIBLE * common name: ** atp-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHALCONE-ISOMERASE-RXN CHALCONE-ISOMERASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
 
* common name:
 
* common name:
−
** atp-dependent_rna_helicase_dhx30-like
+
** nicotine-glucuronide
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/5.5.1.6 EC-5.5.1.6]
+
** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
 +
* molecular weight:
 +
** 339.367   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Chalcones]][c] '''<=>''' 1 [[FLAVANONES]][c]
+
* [[RXN66-83]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a chalcone[c] '''<=>''' 1 a flavanone[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_13414]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07344 R07344]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
−
* UNIPROT:
+
* HMDB : HMDB01272
−
** [http://www.uniprot.org/uniprot/P11650 P11650]
+
{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
−
** [http://www.uniprot.org/uniprot/P11651 P11651]
+
{{#set: common name=nicotine-glucuronide}}
−
** [http://www.uniprot.org/uniprot/P41088 P41088]
+
{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
−
** [http://www.uniprot.org/uniprot/P14298 P14298]
+
{{#set: molecular weight=339.367    }}
−
** [http://www.uniprot.org/uniprot/Q42925 Q42925]
+
{{#set: produced by=RXN66-83}}
−
** [http://www.uniprot.org/uniprot/Q42926 Q42926]
+
−
** [http://www.uniprot.org/uniprot/Q08704 Q08704]
+
−
** [http://www.uniprot.org/uniprot/P28012 P28012]
+
−
** [http://www.uniprot.org/uniprot/P41089 P41089]
+
−
** [http://www.uniprot.org/uniprot/O81980 O81980]
+
−
** [http://www.uniprot.org/uniprot/O22604 O22604]
+
−
** [http://www.uniprot.org/uniprot/O22651 O22651]
+
−
** [http://www.uniprot.org/uniprot/Q43754 Q43754]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=atp-dependent_rna_helicase_dhx30-like}}
+
−
{{#set: ec number=EC-5.5.1.6}}
+
−
{{#set: gene associated=Tiso_gene_13414}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:42, 21 March 2018

Metabolite CPD-2744

  • smiles:
    • C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
  • common name:
    • nicotine-glucuronide
  • inchi key:
    • InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
  • molecular weight:
    • 339.367
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-2744&oldid=43351"