Difference between revisions of "3.2.1.18-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.18-RXN 3.2.1.18-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** sialidase ** neuramid...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.18-RXN 3.2.1.18-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** sialidase |
− | * | + | ** neuramidase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.2.1.18 EC-3.2.1.18] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[Sialyloligosaccharides]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[N-ACETYLNEURAMINATE]][c] '''+''' 1 [[Oligosaccharides]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 a sialyloligosaccharide[c] '''+''' 1 H2O[c] '''=>''' 1 N-acetylneuraminate[c] '''+''' 1 an oligosaccharide[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9616]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18808]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18807]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17759]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17758]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P37060 P37060] |
− | * | + | ** [http://www.uniprot.org/uniprot/P15698 P15698] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P18269 P18269] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q02834 Q02834] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16199 P16199] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q64627 Q64627] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q03625 Q03625] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P67907 P67907] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P67923 P67923] |
+ | ** [http://www.uniprot.org/uniprot/P16207 P16207] | ||
+ | ** [http://www.uniprot.org/uniprot/P16205 P16205] | ||
+ | ** [http://www.uniprot.org/uniprot/P16201 P16201] | ||
+ | ** [http://www.uniprot.org/uniprot/P16203 P16203] | ||
+ | ** [http://www.uniprot.org/uniprot/P16191 P16191] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59310 Q59310] | ||
+ | ** [http://www.uniprot.org/uniprot/P16195 P16195] | ||
+ | ** [http://www.uniprot.org/uniprot/P31206 P31206] | ||
+ | ** [http://www.uniprot.org/uniprot/P77848 P77848] | ||
+ | ** [http://www.uniprot.org/uniprot/P23253 P23253] | ||
+ | ** [http://www.uniprot.org/uniprot/Q67055 Q67055] | ||
+ | ** [http://www.uniprot.org/uniprot/P29767 P29767] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9R5J8 Q9R5J8] | ||
+ | ** [http://www.uniprot.org/uniprot/P03473 P03473] | ||
+ | ** [http://www.uniprot.org/uniprot/P03474 P03474] | ||
+ | ** [http://www.uniprot.org/uniprot/P03472 P03472] | ||
+ | ** [http://www.uniprot.org/uniprot/P27907 P27907] | ||
+ | ** [http://www.uniprot.org/uniprot/P03478 P03478] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7LZZ6 Q7LZZ6] | ||
+ | ** [http://www.uniprot.org/uniprot/P10481 P10481] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59164 Q59164] | ||
+ | ** [http://www.uniprot.org/uniprot/Q90021 Q90021] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59311 Q59311] | ||
+ | ** [http://www.uniprot.org/uniprot/P62575 P62575] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=sialidase}} | ||
+ | {{#set: common name=neuramidase}} | ||
+ | {{#set: ec number=EC-3.2.1.18}} | ||
+ | {{#set: gene associated=Tiso_gene_9616|Tiso_gene_18808|Tiso_gene_18807|Tiso_gene_17759|Tiso_gene_17758}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:42, 21 March 2018
Contents
Reaction 3.2.1.18-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- sialidase
- neuramidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Sialyloligosaccharides[c] + 1 WATER[c] => 1 N-ACETYLNEURAMINATE[c] + 1 Oligosaccharides[c]
- With common name(s):
- 1 a sialyloligosaccharide[c] + 1 H2O[c] => 1 N-acetylneuraminate[c] + 1 an oligosaccharide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9616
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18808
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18807
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17759
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17758
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- UNIPROT: