Difference between revisions of "Tiso gene 3535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...")
(Created page with "Category:Gene == Gene Tiso_gene_3535 == * Synonym(s): == Reactions associated == * Reaction: GSHTRAN-RXN ** Source: orthology-esiliculosus == Pathways associated...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
+
== Gene Tiso_gene_3535 ==
* smiles:
+
** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
+
* inchi key:
+
** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
+
* common name:
+
** nicotine-glucuronide
+
* molecular weight:
+
** 339.367   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GSHTRAN-RXN]]
* [[RXN66-83]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=GSHTRAN-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
+
{{#set: pathway associated=PWY-6842|PWY-4061}}
* HMDB : HMDB01272
+
{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
+
{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
+
{{#set: common name=nicotine-glucuronide}}
+
{{#set: molecular weight=339.367    }}
+
{{#set: produced by=RXN66-83}}
+

Latest revision as of 19:42, 21 March 2018

Gene Tiso_gene_3535

  • Synonym(s):

Reactions associated

Pathways associated

External links