Difference between revisions of "Tiso gene 237"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == * smiles: ** C=CC2(C(C)=C4(C=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_237 == * right end position: ** 13972 * transcription direction: ** POSITIVE * left end position: ** 11065 * centisome position: ** 29.9207...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] ==
+
== Gene Tiso_gene_237 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))
+
** 13972
−
* common name:
+
* transcription direction:
−
** 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester
+
** POSITIVE
−
* molecular weight:
+
* left end position:
−
** 613.974    
+
** 11065
 +
* centisome position:
 +
** 29.920769    
 
* Synonym(s):
 
* Synonym(s):
−
** 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-5283]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-5282]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13972}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658233 90658233]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB02379
+
{{#set: left end position=11065}}
−
* CHEBI:
+
{{#set: centisome position=29.920769    }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60489 60489]
+
{{#set: reaction associated=ATPASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11829 C11829]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))}}
+
−
{{#set: common name=131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=613.974    }}
+
−
{{#set: common name=131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: consumed by=RXN-5283}}
+
−
{{#set: produced by=RXN-5282}}
+

Latest revision as of 19:42, 21 March 2018

Gene Tiso_gene_237

  • right end position:
    • 13972
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11065
  • centisome position:
    • 29.920769
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_237&oldid=43375"