Difference between revisions of "PWY-7778"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * smiles: ** C(OP([O-...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7778 PWY-7778] ==
* smiles:
+
* taxonomic range:
** C(OP([O-])(OCC(CO)O)=O)C[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N
+
 
* common name:
 
* common name:
** sn-glycero-3-phosphoethanolamine
+
** 2-methylpropene degradation
* molecular weight:
+
** 215.142   
+
 
* Synonym(s):
 
* Synonym(s):
** L-1-glycerophosphorylethanolamine
 
** 1-glycerophosphorylethanolamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14160]]
+
'''2''' reactions found over '''8''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
* [[RXN-15035]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_16181]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_17451]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11662]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_16703]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_18838]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_5857]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17588 RXN-17588]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17589 RXN-17589]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17602 RXN-17602]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17603 RXN-17603]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17605 RXN-17605]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17606 RXN-17606]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C01233 C01233]
+
{{#set: common name=2-methylpropene degradation}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16929 16929]
+
{{#set: total reaction=8}}
* BIGG : g3pe
+
{{#set: completion rate=25.0}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678815 70678815]
+
* HMDB : HMDB00114
+
{{#set: smiles=C(OP([O-])(OCC(CO)O)=O)C[N+]}}
+
{{#set: inchi key=InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N}}
+
{{#set: common name=sn-glycero-3-phosphoethanolamine}}
+
{{#set: molecular weight=215.142    }}
+
{{#set: common name=L-1-glycerophosphorylethanolamine|1-glycerophosphorylethanolamine}}
+
{{#set: consumed by=RXN-14160}}
+
{{#set: produced by=RXN-15035}}
+

Latest revision as of 19:43, 21 March 2018

Pathway PWY-7778

  • taxonomic range:
  • common name:
    • 2-methylpropene degradation
  • Synonym(s):

Reaction(s) found

2 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links