Difference between revisions of "R00946"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00946 R00946] == * direction: ** LEFT-TO-RIGHT * common name: ** R193 * Synonym(s): == Reaction F...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R00946 R00946] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** R193 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[5-METHYL-THF]][c] '''+''' 1.0 [[HOMO-CYS]][c] '''=>''' 1.0 [[MET]][c] '''+''' 1.0 [[THF]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 N5-methyl-tetrahydropteroyl mono-L-glutamate[c] '''+''' 1.0 L-homocysteine[c] '''=>''' 1.0 L-methionine[c] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_1602]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=R193}} | |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_1602}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-synechocystis}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:43, 21 March 2018
Contents
Reaction R00946
- direction:
- LEFT-TO-RIGHT
- common name:
- R193
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 5-METHYL-THF[c] + 1.0 HOMO-CYS[c] => 1.0 MET[c] + 1.0 THF[c]
- With common name(s):
- 1.0 N5-methyl-tetrahydropteroyl mono-L-glutamate[c] + 1.0 L-homocysteine[c] => 1.0 L-methionine[c] + 1.0 tetrahydropteroyl mono-L-glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1602
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
