Difference between revisions of "Charged-SER-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == * smiles: ** C=CC2(C(C)=C4(C=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-SER-tRNAs Charged-SER-tRNAs] == * common name: ** an L-seryl-[tRNAser] * Synonym(s): **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-SER-tRNAs Charged-SER-tRNAs] ==
−
* smiles:
+
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))
+
 
* common name:
 
* common name:
−
** 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester
+
** an L-seryl-[tRNAser]
−
* molecular weight:
+
−
** 613.974   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester
+
** L-SERYL-TRNA(SER)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-5283]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-5282]]
+
* [[SERINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an L-seryl-[tRNAser]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658233 90658233]
+
{{#set: common name=L-SERYL-TRNA(SER)}}
−
* HMDB : HMDB02379
+
{{#set: produced by=SERINE--TRNA-LIGASE-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60489 60489]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11829 C11829]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))}}
+
−
{{#set: common name=131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: molecular weight=613.974    }}
+
−
{{#set: common name=131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester}}
+
−
{{#set: consumed by=RXN-5283}}
+
−
{{#set: produced by=RXN-5282}}
+

Latest revision as of 19:43, 21 March 2018

Metabolite Charged-SER-tRNAs

  • common name:
    • an L-seryl-[tRNAser]
  • Synonym(s):
    • L-SERYL-TRNA(SER)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-seryl-[tRNAser" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Charged-SER-tRNAs&oldid=43409"